C24H16BNO — CID 164930481
3,4,5,6-tetradeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)-13-oxa-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-amine (PubChem CID 164930481) has the molecular formula C24H16BNO and a molecular weight of 354.26 g/mol. Its IUPAC name is 3,4,5,6-tetradeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)-13-oxa-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-amine.
| Compound Name | 3,4,5,6-tetradeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)-13-oxa-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-amine |
|---|---|
| PubChem CID | 164930481 |
| Molecular Formula | C24H16BNO |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 3,4,5,6-tetradeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)-13-oxa-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20),9,11,14(19),15,17-nonaen-16-amine |
| SMILES | [2H]c1c([2H])c([2H])c(Nc2ccc3c(c2)Oc2cccc4c2B3c2c([2H])c([2H])c([2H])c([2H])c2-4)c([2H])c1[2H] |
| InChI | InChI=1S/C24H16BNO/c1-2-7-16(8-3-1)26-17-13-14-21-23(15-17)27-22-12-6-10-19-18-9-4-5-11-20(18)25(21)24(19)22/h1-15,26H/i1D,2D,3D,4D,5D,7D,8D,9D,11D |
| InChIKey | RSJYROKNHVZXDK-DZQUKBDMSA-N |
| XLogP | 4.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|