About 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid
4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid (PubChem CID 164932522) has the molecular formula C7H7N3O3
and a molecular weight of 181.15 g/mol. Its IUPAC name is 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid |
| PubChem CID | 164932522 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid |
| SMILES | C=CCOc1ncnc(C(=O)O)n1 |
| InChI | InChI=1S/C7H7N3O3/c1-2-3-13-7-9-4-8-5(10-7)6(11)12/h2,4H,1,3H2,(H,11,12) |
| InChIKey | AXCRYLZVWBEELG-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid?
The IUPAC name of 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid (CID 164932522) is 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid.
What is the SMILES notation for 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid?
The canonical SMILES for 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid is C=CCOc1ncnc(C(=O)O)n1.
What is the InChIKey of 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid?
The InChIKey is AXCRYLZVWBEELG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O3/c1-2-3-13-7-9-4-8-5(10-7)6(11)12/h2,4H,1,3H2,(H,11,12).
What are the key properties of 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid?
4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.13, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-prop-2-enoxy-1,3,5-triazine-2-carboxylic acid is sourced from PubChem (CID 164932522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).