C22H32O3Si — CID 164932609
(1S,4aR,4bR,8aR,10aS)-6,9-dimethyl-1-triethylsilyloxy-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione (PubChem CID 164932609) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (1S,4aR,4bR,8aR,10aS)-6,9-dimethyl-1-triethylsilyloxy-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione.
| Compound Name | (1S,4aR,4bR,8aR,10aS)-6,9-dimethyl-1-triethylsilyloxy-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione |
|---|---|
| PubChem CID | 164932609 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (1S,4aR,4bR,8aR,10aS)-6,9-dimethyl-1-triethylsilyloxy-1,4a,4b,8,8a,10a-hexahydrophenanthrene-4,5-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1C=CC(=O)[C@@H]2[C@@H]1C=C(C)[C@@H]1CC=C(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C22H32O3Si/c1-6-26(7-2,8-3)25-19-12-11-18(23)20-17(19)13-15(5)16-10-9-14(4)22(24)21(16)20/h9,11-13,16-17,19-21H,6-8,10H2,1-5H3/t16-,17+,19-,20-,21+/m0/s1 |
| InChIKey | AIEVIOBQYKOPGL-YZUZWNONSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|