C45H26N4O2 — CID 164932795
7-[4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-b]carbazole (PubChem CID 164932795) has the molecular formula C45H26N4O2 and a molecular weight of 665.80 g/mol. Its IUPAC name is 7-[4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-b]carbazole.
| Compound Name | 7-[4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-b]carbazole |
|---|---|
| PubChem CID | 164932795 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 665.80 g/mol |
| Exact Mass | 665.27 |
| IUPAC Name | 7-[4-[1,2,4,6,7,8-hexadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-6-phenyl-1,3,5-triazin-2-yl]-[1]benzofuro[2,3-b]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c3oc4c([2H])c(-c5nc(-c6ccccc6)nc(-n6c7ccccc7c7cc8c(cc76)oc6ccccc68)n5)c([2H])c([2H])c4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4O2/c1-3-12-27(13-4-1)30-18-11-21-39-42(30)33-23-22-29(24-40(33)51-39)44-46-43(28-14-5-2-6-15-28)47-45(48-44)49-36-19-9-7-16-31(36)34-25-35-32-17-8-10-20-38(32)50-41(35)26-37(34)49/h1-26H/i1D,3D,4D,11D,12D,13D,18D,21D,22D,23D,24D |
| InChIKey | SFSAMLCCXSDKEX-CXTRMUQJSA-N |
| XLogP | 11.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.80 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |