C57H34N4OS — CID 164932940
14-[4-(3,5-diphenylphenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 164932940) has the molecular formula C57H34N4OS and a molecular weight of 822.99 g/mol. Its IUPAC name is 14-[4-(3,5-diphenylphenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 14-[4-(3,5-diphenylphenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 164932940 |
| Molecular Formula | C57H34N4OS |
| Molecular Weight | 822.99 g/mol |
| Exact Mass | 822.25 |
| IUPAC Name | 14-[4-(3,5-diphenylphenyl)-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3nc(-c4ccc5c(c4)oc4cccc(-c6ccccc6)c45)nc(-n4c5ccccc5c5c6c(ccc54)sc4ccccc46)n3)c2)cc1 |
| InChI | InChI=1S/C57H34N4OS/c1-4-15-35(16-5-1)39-31-40(36-17-6-2-7-18-36)33-41(32-39)56-58-55(38-27-28-44-49(34-38)62-48-25-14-23-42(52(44)48)37-19-8-3-9-20-37)59-57(60-56)61-46-24-12-10-21-43(46)53-47(61)29-30-51-54(53)45-22-11-13-26-50(45)63-51/h1-34H |
| InChIKey | JHJAZMAHGVNDQK-UHFFFAOYSA-N |
| XLogP | 15.57 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.99 |
| LogP ≤ 5 | 15.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |