C45H26N4O2 — CID 164933012
5-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole (PubChem CID 164933012) has the molecular formula C45H26N4O2 and a molecular weight of 664.79 g/mol. Its IUPAC name is 5-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 5-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 164933012 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 664.79 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 5-[4-(2,3,4,5,6-pentadeuteriophenyl)-6-[9-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-3-yl]-1,3,5-triazin-2-yl]-[1]benzofuro[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc4c(c3)oc3cccc(-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c34)nc(-n3c4ccccc4c4c5oc6ccccc6c5ccc43)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C45H26N4O2/c1-3-12-27(13-4-1)30-18-11-21-38-40(30)34-23-22-29(26-39(34)50-38)44-46-43(28-14-5-2-6-15-28)47-45(48-44)49-35-19-9-7-17-33(35)41-36(49)25-24-32-31-16-8-10-20-37(31)51-42(32)41/h1-26H/i1D,2D,3D,4D,5D,6D,12D,13D,14D,15D |
| InChIKey | BRWPTSTXFVCWGA-RXOJMXQBSA-N |
| XLogP | 11.77 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.79 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |