C20H29NO5 — CID 164933256
2-O-(2-methoxyethyl) 1-O-[2-(N-methylanilino)ethyl] cyclohexane-1,2-dicarboxylate (PubChem CID 164933256) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-O-(2-methoxyethyl) 1-O-[2-(N-methylanilino)ethyl] cyclohexane-1,2-dicarboxylate.
| Compound Name | 2-O-(2-methoxyethyl) 1-O-[2-(N-methylanilino)ethyl] cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164933256 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-O-(2-methoxyethyl) 1-O-[2-(N-methylanilino)ethyl] cyclohexane-1,2-dicarboxylate |
| SMILES | COCCOC(=O)C1CCCCC1C(=O)OCCN(C)c1ccccc1 |
| InChI | InChI=1S/C20H29NO5/c1-21(16-8-4-3-5-9-16)12-13-25-19(22)17-10-6-7-11-18(17)20(23)26-15-14-24-2/h3-5,8-9,17-18H,6-7,10-15H2,1-2H3 |
| InChIKey | XHYOMMFZIICAFU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|