C26H33N5O4S2 — CID 164934874
5-[(1R)-1-(6-ethylsulfonyl-3-pyridinyl)-3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide (PubChem CID 164934874) has the molecular formula C26H33N5O4S2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 5-[(1R)-1-(6-ethylsulfonyl-3-pyridinyl)-3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide.
| Compound Name | 5-[(1R)-1-(6-ethylsulfonyl-3-pyridinyl)-3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 164934874 |
| Molecular Formula | C26H33N5O4S2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 5-[(1R)-1-(6-ethylsulfonyl-3-pyridinyl)-3-(4-hydroxypiperidin-1-yl)propyl]-5,6,7,8-tetrahydro-[1,3]thiazolo[5,4-b]quinoline-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CCN2CCC(O)CC2)C2CCCc3cc4nc(C(N)=O)sc4nc32)cn1 |
| InChI | InChI=1S/C26H33N5O4S2/c1-2-37(34,35)22-7-6-17(15-28-22)19(10-13-31-11-8-18(32)9-12-31)20-5-3-4-16-14-21-25(30-23(16)20)36-26(29-21)24(27)33/h6-7,14-15,18-20,32H,2-5,8-13H2,1H3,(H2,27,33)/t19-,20?/m0/s1 |
| InChIKey | QGSMIHNJLPEBJB-XJDOXCRVSA-N |
| XLogP | 3.03 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |