C13H18O6 — CID 164935152
(3aR,4R)-3'-ethoxy-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one (PubChem CID 164935152) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3aR,4R)-3'-ethoxy-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one.
| Compound Name | (3aR,4R)-3'-ethoxy-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
|---|---|
| PubChem CID | 164935152 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (3aR,4R)-3'-ethoxy-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
| SMILES | CCOC1=CC(=O)[C@]12OC(OC)C1OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H18O6/c1-5-16-8-6-7(14)13(8)10-9(11(15-4)19-13)17-12(2,3)18-10/h6,9-11H,5H2,1-4H3/t9?,10-,11?,13+/m1/s1 |
| InChIKey | BWWSHHDAQWJKHM-DTZXXLCVSA-N |
| XLogP | 0.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |