C14H22O5Si — CID 164935238
(4S,6aS)-6-methoxy-2,2-dimethyl-3'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one (PubChem CID 164935238) has the molecular formula C14H22O5Si and a molecular weight of 298.41 g/mol. Its IUPAC name is (4S,6aS)-6-methoxy-2,2-dimethyl-3'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one.
| Compound Name | (4S,6aS)-6-methoxy-2,2-dimethyl-3'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
|---|---|
| PubChem CID | 164935238 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (4S,6aS)-6-methoxy-2,2-dimethyl-3'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
| SMILES | COC1O[C@]2(C(=O)C=C2[Si](C)(C)C)C2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C14H22O5Si/c1-13(2)17-10-11(18-13)14(19-12(10)16-3)8(15)7-9(14)20(4,5)6/h7,10-12H,1-6H3/t10-,11?,12?,14-/m0/s1 |
| InChIKey | SVXGENHEIGQBOS-BBCYWQGDSA-N |
| XLogP | 1.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|