C15H24O5Si — CID 164935267
(4S,6aS)-6-methoxy-2,2,3'-trimethyl-2'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one (PubChem CID 164935267) has the molecular formula C15H24O5Si and a molecular weight of 312.44 g/mol. Its IUPAC name is (4S,6aS)-6-methoxy-2,2,3'-trimethyl-2'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one.
| Compound Name | (4S,6aS)-6-methoxy-2,2,3'-trimethyl-2'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
|---|---|
| PubChem CID | 164935267 |
| Molecular Formula | C15H24O5Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (4S,6aS)-6-methoxy-2,2,3'-trimethyl-2'-trimethylsilylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,4'-cyclobut-2-ene]-1'-one |
| SMILES | COC1O[C@]2(C(=O)C([Si](C)(C)C)=C2C)C2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O5Si/c1-8-10(21(5,6)7)11(16)15(8)12-9(13(17-4)20-15)18-14(2,3)19-12/h9,12-13H,1-7H3/t9-,12?,13?,15+/m0/s1 |
| InChIKey | VDKYONXAEMYDFD-PUZVGVIGSA-N |
| XLogP | 2.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|