C21H25N3O9 — CID 164936574
2-[(2R,3R,4S)-6-carboxy-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-4-yl]indazole-5-carboxylic acid (PubChem CID 164936574) has the molecular formula C21H25N3O9 and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-[(2R,3R,4S)-6-carboxy-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-4-yl]indazole-5-carboxylic acid.
| Compound Name | 2-[(2R,3R,4S)-6-carboxy-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-4-yl]indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 164936574 |
| Molecular Formula | C21H25N3O9 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[(2R,3R,4S)-6-carboxy-3-(2-methylpropanoylamino)-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-4-yl]indazole-5-carboxylic acid |
| SMILES | CC(C)C(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)OC(C(=O)O)=C[C@@H]1n1cc2cc(C(=O)O)ccc2n1 |
| InChI | InChI=1S/C21H25N3O9/c1-9(2)19(28)22-16-13(6-15(21(31)32)33-18(16)17(27)14(26)8-25)24-7-11-5-10(20(29)30)3-4-12(11)23-24/h3-7,9,13-14,16-18,25-27H,8H2,1-2H3,(H,22,28)(H,29,30)(H,31,32)/t13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | CYKJJOBGMPONJK-QBBQCFRVSA-N |
| XLogP | -0.50 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |