C20H20F3N5OS — CID 164936651
trans-(1S,2R)-N-[5-[5-[(4,4-difluoropiperidin-1-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 164936651) has the molecular formula C20H20F3N5OS and a molecular weight of 435.48 g/mol. Its IUPAC name is trans-(1S,2R)-N-[5-[5-[(4,4-difluoropiperidin-1-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2R)-N-[5-[5-[(4,4-difluoropiperidin-1-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 164936651 |
| Molecular Formula | C20H20F3N5OS |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | trans-(1S,2R)-N-[5-[5-[(4,4-difluoropiperidin-1-yl)methyl]thiophen-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nc2cccc(-c3ccc(CN4CCC(F)(F)CC4)s3)n2n1)[C@@H]1C[C@H]1F |
| InChI | InChI=1S/C20H20F3N5OS/c21-14-10-13(14)18(29)25-19-24-17-3-1-2-15(28(17)26-19)16-5-4-12(30-16)11-27-8-6-20(22,23)7-9-27/h1-5,13-14H,6-11H2,(H,25,26,29)/t13-,14-/m1/s1 |
| InChIKey | RWNRZBMAJDGVBV-ZIAGYGMSSA-N |
| XLogP | 3.99 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |