C31H54O3Si — CID 164938304
methyl (8E,10Z,13Z,16Z,19Z)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyldocosa-8,10,13,16,19-pentaenoate (PubChem CID 164938304) has the molecular formula C31H54O3Si and a molecular weight of 502.86 g/mol. Its IUPAC name is methyl (8E,10Z,13Z,16Z,19Z)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyldocosa-8,10,13,16,19-pentaenoate.
| Compound Name | methyl (8E,10Z,13Z,16Z,19Z)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyldocosa-8,10,13,16,19-pentaenoate |
|---|---|
| PubChem CID | 164938304 |
| Molecular Formula | C31H54O3Si |
| Molecular Weight | 502.86 g/mol |
| Exact Mass | 502.38 |
| IUPAC Name | methyl (8E,10Z,13Z,16Z,19Z)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyldocosa-8,10,13,16,19-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(CCCCC(C)(C)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H54O3Si/c1-10-11-12-13-14-15-16-17-18-19-20-21-22-25-28(34-35(8,9)30(2,3)4)26-23-24-27-31(5,6)29(32)33-7/h11-12,14-15,17-18,20-22,25,28H,10,13,16,19,23-24,26-27H2,1-9H3/b12-11-,15-14-,18-17-,21-20-,25-22+ |
| InChIKey | AHAYPBORLSOFLQ-JDPZDJCWSA-N |
| XLogP | 9.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.86 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|