About [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate
[4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 164938404) has the molecular formula C10H7F3N2O5S
and a molecular weight of 324.24 g/mol. Its IUPAC name is [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate |
| PubChem CID | 164938404 |
| Molecular Formula | C10H7F3N2O5S |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | COc1ccnc(OS(=O)(=O)C(F)(F)F)c1-c1ccno1 |
| InChI | InChI=1S/C10H7F3N2O5S/c1-18-6-2-4-14-9(8(6)7-3-5-15-19-7)20-21(16,17)10(11,12)13/h2-5H,1H3 |
| InChIKey | SJHVVLPAOFESEP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate?
The IUPAC name of [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate (CID 164938404) is [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate?
The canonical SMILES for [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate is COc1ccnc(OS(=O)(=O)C(F)(F)F)c1-c1ccno1.
What is the InChIKey of [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate?
The InChIKey is SJHVVLPAOFESEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3N2O5S/c1-18-6-2-4-14-9(8(6)7-3-5-15-19-7)20-21(16,17)10(11,12)13/h2-5H,1H3.
What are the key properties of [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate?
[4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate has a molecular weight of 324.24 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-3-(1,2-oxazol-5-yl)-2-pyridinyl] trifluoromethanesulfonate is sourced from PubChem (CID 164938404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).