C38H27N5 — CID 164939367
6-naphthalen-2-yl-N,N-bis[4-(1H-pyrazol-4-yl)phenyl]naphthalen-2-amine (PubChem CID 164939367) has the molecular formula C38H27N5 and a molecular weight of 553.67 g/mol. Its IUPAC name is 6-naphthalen-2-yl-N,N-bis[4-(1H-pyrazol-4-yl)phenyl]naphthalen-2-amine.
| Compound Name | 6-naphthalen-2-yl-N,N-bis[4-(1H-pyrazol-4-yl)phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 164939367 |
| Molecular Formula | C38H27N5 |
| Molecular Weight | 553.67 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | 6-naphthalen-2-yl-N,N-bis[4-(1H-pyrazol-4-yl)phenyl]naphthalen-2-amine |
| SMILES | c1ccc2cc(-c3ccc4cc(N(c5ccc(-c6cn[nH]c6)cc5)c5ccc(-c6cn[nH]c6)cc5)ccc4c3)ccc2c1 |
| InChI | InChI=1S/C38H27N5/c1-2-4-29-19-30(6-5-26(29)3-1)31-7-8-33-21-38(18-13-32(33)20-31)43(36-14-9-27(10-15-36)34-22-39-40-23-34)37-16-11-28(12-17-37)35-24-41-42-25-35/h1-25H,(H,39,40)(H,41,42) |
| InChIKey | QHZPBCUDZDPZAQ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.67 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |