C22H28N2O — CID 164939433
(5aR,9aS)-2,6,6,9a-tetramethyl-3-(3-methylphenyl)-5,5a,8,9-tetrahydro-4H-benzo[g]indazol-7-one (PubChem CID 164939433) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (5aR,9aS)-2,6,6,9a-tetramethyl-3-(3-methylphenyl)-5,5a,8,9-tetrahydro-4H-benzo[g]indazol-7-one.
| Compound Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-(3-methylphenyl)-5,5a,8,9-tetrahydro-4H-benzo[g]indazol-7-one |
|---|---|
| PubChem CID | 164939433 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (5aR,9aS)-2,6,6,9a-tetramethyl-3-(3-methylphenyl)-5,5a,8,9-tetrahydro-4H-benzo[g]indazol-7-one |
| SMILES | Cc1cccc(-c2c3c(nn2C)[C@@]2(C)CCC(=O)C(C)(C)[C@@H]2CC3)c1 |
| InChI | InChI=1S/C22H28N2O/c1-14-7-6-8-15(13-14)19-16-9-10-17-21(2,3)18(25)11-12-22(17,4)20(16)23-24(19)5/h6-8,13,17H,9-12H2,1-5H3/t17-,22-/m0/s1 |
| InChIKey | YHDKWUDYZCCKSK-JTSKRJEESA-N |
| XLogP | 4.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |