C34H26Cl2CoN8O8S2- — CID 164940728
bis(2-[[1-(3-chlorophenyl)-3-methyl-5-oxopyrazol-2-id-4-yl]diazenyl]-4-methylsulfonylphenolate);cobalt(3+) (PubChem CID 164940728) has the molecular formula C34H26Cl2CoN8O8S2- and a molecular weight of 868.60 g/mol. Its IUPAC name is bis(2-[[1-(3-chlorophenyl)-3-methyl-5-oxopyrazol-2-id-4-yl]diazenyl]-4-methylsulfonylphenolate);cobalt(3+).
| Compound Name | bis(2-[[1-(3-chlorophenyl)-3-methyl-5-oxopyrazol-2-id-4-yl]diazenyl]-4-methylsulfonylphenolate);cobalt(3+) |
|---|---|
| PubChem CID | 164940728 |
| Molecular Formula | C34H26Cl2CoN8O8S2- |
| Molecular Weight | 868.60 g/mol |
| Exact Mass | 867.00 |
| IUPAC Name | bis(2-[[1-(3-chlorophenyl)-3-methyl-5-oxopyrazol-2-id-4-yl]diazenyl]-4-methylsulfonylphenolate);cobalt(3+) |
| SMILES | Cc1[n-]n(-c2cccc(Cl)c2)c(=O)c1/N=N/c1cc(S(C)(=O)=O)ccc1[O-].Cc1[n-]n(-c2cccc(Cl)c2)c(=O)c1/N=N/c1cc(S(C)(=O)=O)ccc1[O-].[Co+3] |
| InChI | InChI=1S/2C17H15ClN4O4S.Co/c2*1-10-16(17(24)22(21-10)12-5-3-4-11(18)8-12)20-19-14-9-13(27(2,25)26)6-7-15(14)23;/h2*3-9H,1-2H3,(H2,19,20,21,23,24);/q;;+3/p-4 |
| InChIKey | PMSWAOWTUKPMTH-UHFFFAOYSA-J |
| XLogP | 5.30 |
| TPSA | 236.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|