About 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate
2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate (PubChem CID 164941122) has the molecular formula C10H13N5O2
and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate.
Molecular Properties
| Compound Name | 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate |
| PubChem CID | 164941122 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCNc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C10H13N5O2/c1-11-10(16)17-5-4-13-9-7-2-3-12-8(7)14-6-15-9/h2-3,6H,4-5H2,1H3,(H,11,16)(H2,12,13,14,15) |
| InChIKey | ZAWBLKDCRSMVSF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate?
The IUPAC name of 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate (CID 164941122) is 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate.
What is the SMILES notation for 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate?
The canonical SMILES for 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate is CNC(=O)OCCNc1ncnc2[nH]ccc12.
What is the InChIKey of 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate?
The InChIKey is ZAWBLKDCRSMVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O2/c1-11-10(16)17-5-4-13-9-7-2-3-12-8(7)14-6-15-9/h2-3,6H,4-5H2,1H3,(H,11,16)(H2,12,13,14,15).
What are the key properties of 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate?
2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate has a molecular weight of 235.25 g/mol, XLogP of 0.73, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)ethyl N-methylcarbamate is sourced from PubChem (CID 164941122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).