C8H4F7NO3S — CID 164941135
2,3,4,5-tetrafluoro-N-methyl-6-(trifluoromethoxy)benzenesulfonamide (PubChem CID 164941135) has the molecular formula C8H4F7NO3S and a molecular weight of 327.18 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-methyl-6-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-methyl-6-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 164941135 |
| Molecular Formula | C8H4F7NO3S |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-methyl-6-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1c(F)c(F)c(F)c(F)c1OC(F)(F)F |
| InChI | InChI=1S/C8H4F7NO3S/c1-16-20(17,18)7-5(12)3(10)2(9)4(11)6(7)19-8(13,14)15/h16H,1H3 |
| InChIKey | BAGMMNMNJYIGBA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|