C30H26BrN3O — CID 164941908
[3-[(4-bromophenyl)methyl]-2-naphthalen-1-ylbenzimidazol-5-yl]-piperidin-1-ylmethanone (PubChem CID 164941908) has the molecular formula C30H26BrN3O and a molecular weight of 524.46 g/mol. Its IUPAC name is [3-[(4-bromophenyl)methyl]-2-naphthalen-1-ylbenzimidazol-5-yl]-piperidin-1-ylmethanone.
| Compound Name | [3-[(4-bromophenyl)methyl]-2-naphthalen-1-ylbenzimidazol-5-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 164941908 |
| Molecular Formula | C30H26BrN3O |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [3-[(4-bromophenyl)methyl]-2-naphthalen-1-ylbenzimidazol-5-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc2nc(-c3cccc4ccccc34)n(Cc3ccc(Br)cc3)c2c1)N1CCCCC1 |
| InChI | InChI=1S/C30H26BrN3O/c31-24-14-11-21(12-15-24)20-34-28-19-23(30(35)33-17-4-1-5-18-33)13-16-27(28)32-29(34)26-10-6-8-22-7-2-3-9-25(22)26/h2-3,6-16,19H,1,4-5,17-18,20H2 |
| InChIKey | RILOCCRCYPUHRD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |