C25H27F2NO10S — CID 164941952
tert-butyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethyl)sulfonyloxy-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyhexanoate (PubChem CID 164941952) has the molecular formula C25H27F2NO10S and a molecular weight of 571.55 g/mol. Its IUPAC name is tert-butyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethyl)sulfonyloxy-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyhexanoate.
| Compound Name | tert-butyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethyl)sulfonyloxy-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 164941952 |
| Molecular Formula | C25H27F2NO10S |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | tert-butyl 2-[2-(1,1-difluoro-2-methoxy-2-oxoethyl)sulfonyloxy-1,3-dioxobenzo[de]isoquinolin-5-yl]oxyhexanoate |
| SMILES | CCCCC(Oc1cc2c3c(cccc3c1)C(=O)N(OS(=O)(=O)C(F)(F)C(=O)OC)C2=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H27F2NO10S/c1-6-7-11-18(22(31)37-24(2,3)4)36-15-12-14-9-8-10-16-19(14)17(13-15)21(30)28(20(16)29)38-39(33,34)25(26,27)23(32)35-5/h8-10,12-13,18H,6-7,11H2,1-5H3 |
| InChIKey | BXJFWDLKKTWUCW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|