About 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate
2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate (PubChem CID 164942727) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate |
| PubChem CID | 164942727 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate |
| SMILES | Cc1ncsc1CCOC(=O)CCN |
| InChI | InChI=1S/C9H14N2O2S/c1-7-8(14-6-11-7)3-5-13-9(12)2-4-10/h6H,2-5,10H2,1H3 |
| InChIKey | MFMAVANTFRPKKS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate (CID 164942727) is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate is Cc1ncsc1CCOC(=O)CCN.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate?
The InChIKey is MFMAVANTFRPKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-7-8(14-6-11-7)3-5-13-9(12)2-4-10/h6H,2-5,10H2,1H3.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate?
2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate has a molecular weight of 214.29 g/mol, XLogP of 0.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-aminopropanoate is sourced from PubChem (CID 164942727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).