C11H16N5O2+ — CID 164942772
2-(2H-triazol-4-yl)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate (PubChem CID 164942772) has the molecular formula C11H16N5O2+ and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-(2H-triazol-4-yl)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate.
| Compound Name | 2-(2H-triazol-4-yl)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate |
|---|---|
| PubChem CID | 164942772 |
| Molecular Formula | C11H16N5O2+ |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(2H-triazol-4-yl)ethyl 3-(3-methylimidazol-3-ium-1-yl)propanoate |
| SMILES | C[n+]1ccn(CCC(=O)OCCc2cn[nH]n2)c1 |
| InChI | InChI=1S/C11H16N5O2/c1-15-5-6-16(9-15)4-2-11(17)18-7-3-10-8-12-14-13-10/h5-6,8-9H,2-4,7H2,1H3,(H,12,13,14)/q+1 |
| InChIKey | RDVDSXIAFMJQHN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|