C43H27N3Se — CID 164943527
2,4-diphenyl-6-[5-(6-phenyldibenzoselenophen-4-yl)naphthalen-2-yl]-1,3,5-triazine (PubChem CID 164943527) has the molecular formula C43H27N3Se and a molecular weight of 664.67 g/mol. Its IUPAC name is 2,4-diphenyl-6-[5-(6-phenyldibenzoselenophen-4-yl)naphthalen-2-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[5-(6-phenyldibenzoselenophen-4-yl)naphthalen-2-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 164943527 |
| Molecular Formula | C43H27N3Se |
| Molecular Weight | 664.67 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | 2,4-diphenyl-6-[5-(6-phenyldibenzoselenophen-4-yl)naphthalen-2-yl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(-c5cccc6c5[se]c5c(-c7ccccc7)cccc56)cccc4c3)n2)cc1 |
| InChI | InChI=1S/C43H27N3Se/c1-4-13-28(14-5-1)34-20-11-23-37-38-24-12-22-36(40(38)47-39(34)37)35-21-10-19-31-27-32(25-26-33(31)35)43-45-41(29-15-6-2-7-16-29)44-42(46-43)30-17-8-3-9-18-30/h1-27H |
| InChIKey | FMQVQBNQAACRON-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.67 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|