C37H32F3N5O6S — CID 164944054
3-[6-[2-[2-[[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164944054) has the molecular formula C37H32F3N5O6S and a molecular weight of 731.75 g/mol. Its IUPAC name is 3-[6-[2-[2-[[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[2-[[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164944054 |
| Molecular Formula | C37H32F3N5O6S |
| Molecular Weight | 731.75 g/mol |
| Exact Mass | 731.20 |
| IUPAC Name | 3-[6-[2-[2-[[4-[4-(6-methoxy-1,3-benzothiazol-2-yl)-3-(trifluoromethyl)phenyl]-2-pyridinyl]amino]ethoxy]ethoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1ccc2nc(-c3ccc(-c4ccnc(NCCOCCOc5ccc6c(c5)CN(C5CCC(=O)NC5=O)C6=O)c4)cc3C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C37H32F3N5O6S/c1-49-24-4-7-29-31(19-24)52-35(43-29)27-5-2-21(17-28(27)37(38,39)40)22-10-11-41-32(18-22)42-12-13-50-14-15-51-25-3-6-26-23(16-25)20-45(36(26)48)30-8-9-33(46)44-34(30)47/h2-7,10-11,16-19,30H,8-9,12-15,20H2,1H3,(H,41,42)(H,44,46,47) |
| InChIKey | KKXWAPBVJKYDCS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 131.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|