C31H46FN3O4Si — CID 164944084
ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-1-[(Z)-4-[(1,4,5-trimethylpyrazol-3-yl)methoxy]but-2-enyl]indole-2-carboxylate (PubChem CID 164944084) has the molecular formula C31H46FN3O4Si and a molecular weight of 571.81 g/mol. Its IUPAC name is ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-1-[(Z)-4-[(1,4,5-trimethylpyrazol-3-yl)methoxy]but-2-enyl]indole-2-carboxylate.
| Compound Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-1-[(Z)-4-[(1,4,5-trimethylpyrazol-3-yl)methoxy]but-2-enyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 164944084 |
| Molecular Formula | C31H46FN3O4Si |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | ethyl 3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-fluoro-1-[(Z)-4-[(1,4,5-trimethylpyrazol-3-yl)methoxy]but-2-enyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1c(CCCO[Si](C)(C)C(C)(C)C)c2ccc(F)cc2n1C/C=C\COCc1nn(C)c(C)c1C |
| InChI | InChI=1S/C31H46FN3O4Si/c1-10-38-30(36)29-26(14-13-19-39-40(8,9)31(4,5)6)25-16-15-24(32)20-28(25)35(29)17-11-12-18-37-21-27-22(2)23(3)34(7)33-27/h11-12,15-16,20H,10,13-14,17-19,21H2,1-9H3/b12-11- |
| InChIKey | XEOXXQLTJYSVDO-QXMHVHEDSA-N |
| XLogP | 7.03 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|