C25H21F2N3O — CID 164944594
5-(3,5-difluorophenyl)-1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole (PubChem CID 164944594) has the molecular formula C25H21F2N3O and a molecular weight of 417.46 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole.
| Compound Name | 5-(3,5-difluorophenyl)-1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole |
|---|---|
| PubChem CID | 164944594 |
| Molecular Formula | C25H21F2N3O |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-(3,5-difluorophenyl)-1-(oxan-2-yl)-3-[(E)-2-pyridin-2-ylethenyl]indazole |
| SMILES | Fc1cc(F)cc(-c2ccc3c(c2)c(/C=C/c2ccccn2)nn3C2CCCCO2)c1 |
| InChI | InChI=1S/C25H21F2N3O/c26-19-13-18(14-20(27)16-19)17-7-10-24-22(15-17)23(9-8-21-5-1-3-11-28-21)29-30(24)25-6-2-4-12-31-25/h1,3,5,7-11,13-16,25H,2,4,6,12H2/b9-8+ |
| InChIKey | QYMDSMXHQNKYFW-CMDGGOBGSA-N |
| XLogP | 6.25 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |