C17H27NO3S — CID 164945558
(NE,S)-N-[(3,5-diethoxy-2,4-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 164945558) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is (NE,S)-N-[(3,5-diethoxy-2,4-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(3,5-diethoxy-2,4-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 164945558 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (NE,S)-N-[(3,5-diethoxy-2,4-dimethylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CCOc1cc(/C=N/[S@@](=O)C(C)(C)C)c(C)c(OCC)c1C |
| InChI | InChI=1S/C17H27NO3S/c1-8-20-15-10-14(11-18-22(19)17(5,6)7)12(3)16(13(15)4)21-9-2/h10-11H,8-9H2,1-7H3/b18-11+/t22-/m0/s1 |
| InChIKey | HQBKLTHWSSFACI-VLBBBODESA-N |
| XLogP | 3.98 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|