C35H33BrN2O8 — CID 164946316
ethyl 3-(3,5-dimethoxybenzoyl)-7-[1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-yl]indolizine-1-carboxylate bromide (PubChem CID 164946316) has the molecular formula C35H33BrN2O8 and a molecular weight of 689.56 g/mol. Its IUPAC name is ethyl 3-(3,5-dimethoxybenzoyl)-7-[1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-yl]indolizine-1-carboxylate bromide.
| Compound Name | ethyl 3-(3,5-dimethoxybenzoyl)-7-[1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-yl]indolizine-1-carboxylate bromide |
|---|---|
| PubChem CID | 164946316 |
| Molecular Formula | C35H33BrN2O8 |
| Molecular Weight | 689.56 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | ethyl 3-(3,5-dimethoxybenzoyl)-7-[1-[2-(3,5-dimethoxyphenyl)-2-oxoethyl]pyridin-1-ium-4-yl]indolizine-1-carboxylate bromide |
| SMILES | CCOC(=O)c1cc(C(=O)c2cc(OC)cc(OC)c2)n2ccc(-c3cc[n+](CC(=O)c4cc(OC)cc(OC)c4)cc3)cc12.[Br-] |
| InChI | InChI=1S/C35H33N2O8.BrH/c1-6-45-35(40)30-20-32(34(39)25-15-28(43-4)19-29(16-25)44-5)37-12-9-23(17-31(30)37)22-7-10-36(11-8-22)21-33(38)24-13-26(41-2)18-27(14-24)42-3;/h7-20H,6,21H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | YFGNNMZVTONAHM-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|