C11H8N4O — CID 164946370
(11Z)-4-oxa-12,14,15,16-tetrazatetracyclo[11.2.1.03,14.05,10]hexadeca-1(15),5,7,9,11,13(16)-hexaene (PubChem CID 164946370) has the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. Its IUPAC name is (11Z)-4-oxa-12,14,15,16-tetrazatetracyclo[11.2.1.03,14.05,10]hexadeca-1(15),5,7,9,11,13(16)-hexaene.
| Compound Name | (11Z)-4-oxa-12,14,15,16-tetrazatetracyclo[11.2.1.03,14.05,10]hexadeca-1(15),5,7,9,11,13(16)-hexaene |
|---|---|
| PubChem CID | 164946370 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (11Z)-4-oxa-12,14,15,16-tetrazatetracyclo[11.2.1.03,14.05,10]hexadeca-1(15),5,7,9,11,13(16)-hexaene |
| SMILES | C1=N\c2nc3nn2C(C3)Oc2ccccc2/1 |
| InChI | InChI=1S/C11H8N4O/c1-2-4-8-7(3-1)6-12-11-13-9-5-10(16-8)15(11)14-9/h1-4,6,10H,5H2/b12-6- |
| InChIKey | GNSGVSNPPVCANE-SDQBBNPISA-N |
| XLogP | 1.48 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |