C26H52O6 — CID 164946640
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-2-octyldodecoxy]oxane-3,4,5-triol (PubChem CID 164946640) has the molecular formula C26H52O6 and a molecular weight of 460.70 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-2-octyldodecoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-2-octyldodecoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 164946640 |
| Molecular Formula | C26H52O6 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.38 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2S)-2-octyldodecoxy]oxane-3,4,5-triol |
| SMILES | CCCCCCCCCC[C@H](CCCCCCCC)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H52O6/c1-3-5-7-9-11-12-14-16-18-21(17-15-13-10-8-6-4-2)20-31-26-25(30)24(29)23(28)22(19-27)32-26/h21-30H,3-20H2,1-2H3/t21-,22+,23+,24-,25+,26+/m0/s1 |
| InChIKey | KSONGBHZHOKBGY-LHNRFUMQSA-N |
| XLogP | 4.70 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|