C44H28FN5O7S2 — CID 164946798
5-[2-[[3-[4-amino-3-(1,3-benzothiazol-5-yl)thieno[3,2-c]pyridin-7-yl]-5-fluorobenzoyl]amino]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 164946798) has the molecular formula C44H28FN5O7S2 and a molecular weight of 821.87 g/mol. Its IUPAC name is 5-[2-[[3-[4-amino-3-(1,3-benzothiazol-5-yl)thieno[3,2-c]pyridin-7-yl]-5-fluorobenzoyl]amino]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[2-[[3-[4-amino-3-(1,3-benzothiazol-5-yl)thieno[3,2-c]pyridin-7-yl]-5-fluorobenzoyl]amino]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 164946798 |
| Molecular Formula | C44H28FN5O7S2 |
| Molecular Weight | 821.87 g/mol |
| Exact Mass | 821.14 |
| IUPAC Name | 5-[2-[[3-[4-amino-3-(1,3-benzothiazol-5-yl)thieno[3,2-c]pyridin-7-yl]-5-fluorobenzoyl]amino]ethylcarbamoyl]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Nc1ncc(-c2cc(F)cc(C(=O)NCCNC(=O)c3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)c2)c2scc(-c3ccc4scnc4c3)c12 |
| InChI | InChI=1S/C44H28FN5O7S2/c45-25-12-23(32-18-49-41(46)39-33(19-58-40(32)39)21-2-8-37-34(15-21)50-20-59-37)11-24(13-25)43(54)48-10-9-47-42(53)22-1-5-28(31(14-22)44(55)56)38-29-6-3-26(51)16-35(29)57-36-17-27(52)4-7-30(36)38/h1-8,11-20,51H,9-10H2,(H2,46,49)(H,47,53)(H,48,54)(H,55,56) |
| InChIKey | KMJGNDZKLQHTMC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 197.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.87 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|