C25H23IN2O2Se — CID 164946814
5-[(E)-2-(3-methyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one iodide (PubChem CID 164946814) has the molecular formula C25H23IN2O2Se and a molecular weight of 589.34 g/mol. Its IUPAC name is 5-[(E)-2-(3-methyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one iodide.
| Compound Name | 5-[(E)-2-(3-methyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one iodide |
|---|---|
| PubChem CID | 164946814 |
| Molecular Formula | C25H23IN2O2Se |
| Molecular Weight | 589.34 g/mol |
| Exact Mass | 590.00 |
| IUPAC Name | 5-[(E)-2-(3-methyl-1,3-benzoselenazol-3-ium-2-yl)ethenyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,5,7,9(17)-tetraen-4-one iodide |
| SMILES | C[n+]1c(/C=C/c2cc3cc4c5c(c3oc2=O)CCCN5CCC4)[se]c2ccccc21.[I-] |
| InChI | InChI=1S/C25H23N2O2Se.HI/c1-26-20-8-2-3-9-21(20)30-22(26)11-10-17-15-18-14-16-6-4-12-27-13-5-7-19(23(16)27)24(18)29-25(17)28;/h2-3,8-11,14-15H,4-7,12-13H2,1H3;1H/q+1;/p-1 |
| InChIKey | AJPBZBCGXLRBHE-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|