C23H26F5N4O3S+ — CID 164947940
tert-butyl N-[5-ethylsulfanyl-1-hydroxy-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-N-methylcarbamate (PubChem CID 164947940) has the molecular formula C23H26F5N4O3S+ and a molecular weight of 533.54 g/mol. Its IUPAC name is tert-butyl N-[5-ethylsulfanyl-1-hydroxy-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[5-ethylsulfanyl-1-hydroxy-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 164947940 |
| Molecular Formula | C23H26F5N4O3S+ |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | tert-butyl N-[5-ethylsulfanyl-1-hydroxy-6-[1-(2,2,3,3,3-pentafluoropropyl)pyrrolo[2,3-c]pyridin-5-yl]pyridin-1-ium-3-yl]-N-methylcarbamate |
| SMILES | CCSc1cc(N(C)C(=O)OC(C)(C)C)c[n+](O)c1-c1cc2ccn(CC(F)(F)C(F)(F)F)c2cn1 |
| InChI | InChI=1S/C23H26F5N4O3S/c1-6-36-18-10-15(30(5)20(33)35-21(2,3)4)12-32(34)19(18)16-9-14-7-8-31(17(14)11-29-16)13-22(24,25)23(26,27)28/h7-12,34H,6,13H2,1-5H3/q+1 |
| InChIKey | ADFXUNAOEANKRK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|