C34H54F2N8O2 — CID 164948027
22-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,25-difluoro-17-propan-2-yl-8,9,10,19,21,26-hexazahexacyclo[17.6.2.18,11.02,7.013,18.023,27]octacos-11(28)-en-20-one (PubChem CID 164948027) has the molecular formula C34H54F2N8O2 and a molecular weight of 644.86 g/mol. Its IUPAC name is 22-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,25-difluoro-17-propan-2-yl-8,9,10,19,21,26-hexazahexacyclo[17.6.2.18,11.02,7.013,18.023,27]octacos-11(28)-en-20-one.
| Compound Name | 22-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,25-difluoro-17-propan-2-yl-8,9,10,19,21,26-hexazahexacyclo[17.6.2.18,11.02,7.013,18.023,27]octacos-11(28)-en-20-one |
|---|---|
| PubChem CID | 164948027 |
| Molecular Formula | C34H54F2N8O2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | 22-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,25-difluoro-17-propan-2-yl-8,9,10,19,21,26-hexazahexacyclo[17.6.2.18,11.02,7.013,18.023,27]octacos-11(28)-en-20-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2N2C=C(CC4CCCC(C(C)C)C43)NN2)C[C@H]1C |
| InChI | InChI=1S/C34H54F2N8O2/c1-6-28(45)41-15-20(5)42(16-19(41)4)32-24-14-26(36)30-29-25(35)11-8-12-27(29)43-17-22(39-40-43)13-21-9-7-10-23(18(2)3)31(21)44(33(24)37-30)34(46)38-32/h6,17-21,23-27,29-33,37,39-40H,1,7-16H2,2-5H3,(H,38,46)/t19-,20+,21?,23?,24?,25?,26?,27?,29?,30?,31?,32?,33?/m1/s1 |
| InChIKey | LLYHTZOKPRLBMY-FEKPNWOUSA-N |
| XLogP | 3.60 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|