C23H20N6OS — CID 164950139
22-amino-5,10,16-trimethyl-20-oxa-9-thia-4,5,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),3,8(12),10,13(18),14,16,21,23-decaene-3-carbonitrile (PubChem CID 164950139) has the molecular formula C23H20N6OS and a molecular weight of 428.52 g/mol. Its IUPAC name is 22-amino-5,10,16-trimethyl-20-oxa-9-thia-4,5,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),3,8(12),10,13(18),14,16,21,23-decaene-3-carbonitrile.
| Compound Name | 22-amino-5,10,16-trimethyl-20-oxa-9-thia-4,5,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),3,8(12),10,13(18),14,16,21,23-decaene-3-carbonitrile |
|---|---|
| PubChem CID | 164950139 |
| Molecular Formula | C23H20N6OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 22-amino-5,10,16-trimethyl-20-oxa-9-thia-4,5,11,23-tetrazapentacyclo[19.3.1.02,6.08,12.013,18]pentacosa-1(25),2(6),3,8(12),10,13(18),14,16,21,23-decaene-3-carbonitrile |
| SMILES | Cc1ccc2c(c1)COc1cc(cnc1N)-c1c(C#N)nn(C)c1Cc1sc(C)nc1-2 |
| InChI | InChI=1S/C23H20N6OS/c1-12-4-5-16-15(6-12)11-30-19-7-14(10-26-23(19)25)21-17(9-24)28-29(3)18(21)8-20-22(16)27-13(2)31-20/h4-7,10H,8,11H2,1-3H3,(H2,25,26) |
| InChIKey | AKJQUBLTZRJGFY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|