C22H28ClN5O2 — CID 164950692
1-[1-(3-chloro-4-cyclohexyloxy-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylurea (PubChem CID 164950692) has the molecular formula C22H28ClN5O2 and a molecular weight of 429.95 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-cyclohexyloxy-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylurea.
| Compound Name | 1-[1-(3-chloro-4-cyclohexyloxy-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 164950692 |
| Molecular Formula | C22H28ClN5O2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-[1-(3-chloro-4-cyclohexyloxy-2-pyridinyl)piperidin-4-yl]-3-pyridin-3-ylurea |
| SMILES | O=C(Nc1cccnc1)NC1CCN(c2nccc(OC3CCCCC3)c2Cl)CC1 |
| InChI | InChI=1S/C22H28ClN5O2/c23-20-19(30-18-6-2-1-3-7-18)8-12-25-21(20)28-13-9-16(10-14-28)26-22(29)27-17-5-4-11-24-15-17/h4-5,8,11-12,15-16,18H,1-3,6-7,9-10,13-14H2,(H2,26,27,29) |
| InChIKey | SNKIAGQEHJJQRB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |