C28H26F3NO2 — CID 164950834
2,2-dimethyl-5-[3-(1,1,2-trifluoropropoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 164950834) has the molecular formula C28H26F3NO2 and a molecular weight of 465.52 g/mol. Its IUPAC name is 2,2-dimethyl-5-[3-(1,1,2-trifluoropropoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | 2,2-dimethyl-5-[3-(1,1,2-trifluoropropoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 164950834 |
| Molecular Formula | C28H26F3NO2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2,2-dimethyl-5-[3-(1,1,2-trifluoropropoxy)phenyl]-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | CC(F)C(F)(F)Oc1cccc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C28H26F3NO2/c1-16(29)28(30,31)34-19-9-6-8-18(13-19)26-25-21(14-27(2,3)15-23(25)33)24-20-10-5-4-7-17(20)11-12-22(24)32-26/h4-13,16,26,32H,14-15H2,1-3H3 |
| InChIKey | AMUDOJZSQDHMBF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |