C22H36N2O10 — CID 164951396
ditert-butyl 2,5-dioxopiperazine-1,4-dicarboxylate;4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 164951396) has the molecular formula C22H36N2O10 and a molecular weight of 488.53 g/mol. Its IUPAC name is ditert-butyl 2,5-dioxopiperazine-1,4-dicarboxylate;4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | ditert-butyl 2,5-dioxopiperazine-1,4-dicarboxylate;4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 164951396 |
| Molecular Formula | C22H36N2O10 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | ditert-butyl 2,5-dioxopiperazine-1,4-dicarboxylate;4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)CCC(=O)O.CC(C)(C)OC(=O)N1CC(=O)N(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C14H22N2O6.C8H14O4/c1-13(2,3)21-11(19)15-7-10(18)16(8-9(15)17)12(20)22-14(4,5)6;1-8(2,3)12-7(11)5-4-6(9)10/h7-8H2,1-6H3;4-5H2,1-3H3,(H,9,10) |
| InChIKey | AOTWQEIAWJQFCL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 156.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|