About 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole
2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole (PubChem CID 164952304) has the molecular formula C19H39N3
and a molecular weight of 309.54 g/mol. Its IUPAC name is 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole.
Molecular Properties
| Compound Name | 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole |
| PubChem CID | 164952304 |
| Molecular Formula | C19H39N3 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.31 |
| IUPAC Name | 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole |
| SMILES | C/C(N)=N\CC(C)C.CC(C)CC1=CCC=N1.CCC(C)C |
| InChI | InChI=1S/C8H13N.C6H14N2.C5H12/c1-7(2)6-8-4-3-5-9-8;1-5(2)4-8-6(3)7;1-4-5(2)3/h4-5,7H,3,6H2,1-2H3;5H,4H2,1-3H3,(H2,7,8);5H,4H2,1-3H3 |
| InChIKey | ARXWPHNXRVPFDL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole?
The IUPAC name of 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole (CID 164952304) is 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole.
What is the SMILES notation for 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole?
The canonical SMILES for 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole is C/C(N)=N\CC(C)C.CC(C)CC1=CCC=N1.CCC(C)C.
What is the InChIKey of 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole?
The InChIKey is ARXWPHNXRVPFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C6H14N2.C5H12/c1-7(2)6-8-4-3-5-9-8;1-5(2)4-8-6(3)7;1-4-5(2)3/h4-5,7H,3,6H2,1-2H3;5H,4H2,1-3H3,(H2,7,8);5H,4H2,1-3H3.
What are the key properties of 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole?
2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole has a molecular weight of 309.54 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;N'-(2-methylpropyl)ethanimidamide;5-(2-methylpropyl)-3H-pyrrole is sourced from PubChem (CID 164952304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).