C22H20F5NO3S — CID 164953008
N-cyclopentyl-2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide (PubChem CID 164953008) has the molecular formula C22H20F5NO3S and a molecular weight of 473.46 g/mol. Its IUPAC name is N-cyclopentyl-2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-cyclopentyl-2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 164953008 |
| Molecular Formula | C22H20F5NO3S |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-cyclopentyl-2,3,4,5,6-pentafluoro-N-[[4-[(E)-3-oxobut-1-enyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CC(=O)/C=C/c1ccc(CN(C2CCCC2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H20F5NO3S/c1-13(29)6-7-14-8-10-15(11-9-14)12-28(16-4-2-3-5-16)32(30,31)22-20(26)18(24)17(23)19(25)21(22)27/h6-11,16H,2-5,12H2,1H3/b7-6+ |
| InChIKey | HWGWNLWRFRNYCQ-VOTSOKGWSA-N |
| XLogP | 5.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|