C25H44F6O12 — CID 164953029
6-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]hexan-2-ol (PubChem CID 164953029) has the molecular formula C25H44F6O12 and a molecular weight of 650.60 g/mol. Its IUPAC name is 6-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]hexan-2-ol.
| Compound Name | 6-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]hexan-2-ol |
|---|---|
| PubChem CID | 164953029 |
| Molecular Formula | C25H44F6O12 |
| Molecular Weight | 650.60 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | 6-but-3-enoxy-1-[3-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(2-hydroxyethoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]-2-hydroxypropoxy]hexan-2-ol |
| SMILES | C=CCCOCCCCC(O)COCC(O)COCCOCC(F)(F)OC(F)(F)OC(F)(F)COCC(O)COCCO |
| InChI | InChI=1S/C25H44F6O12/c1-2-3-8-36-9-5-4-6-20(33)13-40-16-21(34)15-38-11-12-39-18-23(26,27)42-25(30,31)43-24(28,29)19-41-17-22(35)14-37-10-7-32/h2,20-22,32-35H,1,3-19H2 |
| InChIKey | AUHXMZXSRRCASF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.60 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|