C34H51NO6 — CID 164954935
(2Z,4Z,6E,8S)-N-[(3S,6Z,9S,11Z)-2,2-dimethyl-4-oxo-9-propan-2-yloxytrideca-6,11-dien-3-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide (PubChem CID 164954935) has the molecular formula C34H51NO6 and a molecular weight of 569.78 g/mol. Its IUPAC name is (2Z,4Z,6E,8S)-N-[(3S,6Z,9S,11Z)-2,2-dimethyl-4-oxo-9-propan-2-yloxytrideca-6,11-dien-3-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide.
| Compound Name | (2Z,4Z,6E,8S)-N-[(3S,6Z,9S,11Z)-2,2-dimethyl-4-oxo-9-propan-2-yloxytrideca-6,11-dien-3-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide |
|---|---|
| PubChem CID | 164954935 |
| Molecular Formula | C34H51NO6 |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.37 |
| IUPAC Name | (2Z,4Z,6E,8S)-N-[(3S,6Z,9S,11Z)-2,2-dimethyl-4-oxo-9-propan-2-yloxytrideca-6,11-dien-3-yl]-8-[(2S)-5-methoxy-6-oxo-2,3-dihydropyran-2-yl]-6-methylnona-2,4,6-trienamide |
| SMILES | C/C=C\C[C@@H](C/C=C\CC(=O)[C@@H](NC(=O)/C=C\C=C/C(C)=C/[C@H](C)[C@@H]1CC=C(OC)C(=O)O1)C(C)(C)C)OC(C)C |
| InChI | InChI=1S/C34H51NO6/c1-10-11-17-27(40-24(2)3)18-13-14-19-28(36)32(34(6,7)8)35-31(37)20-15-12-16-25(4)23-26(5)29-21-22-30(39-9)33(38)41-29/h10-16,20,22-24,26-27,29,32H,17-19,21H2,1-9H3,(H,35,37)/b11-10-,14-13-,16-12-,20-15-,25-23+/t26-,27-,29-,32+/m0/s1 |
| InChIKey | TYAREWLWEDJMBD-QZDXZECDSA-N |
| XLogP | 6.72 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|