About CID 164955048
CID 164955048 (PubChem CID 164955048) has the molecular formula C48H48N2O6S2
and a molecular weight of 813.05 g/mol.
Molecular Properties
| Compound Name | CID 164955048 |
| PubChem CID | 164955048 |
| Molecular Formula | C48H48N2O6S2 |
| Molecular Weight | 813.05 g/mol |
| Exact Mass | 812.30 |
| IUPAC Name | — |
| SMILES | O=C1C(=Nc2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)c6cc(N=C7C(=O)C8CCCCC8C7=O)sc6C5=CC4C=C2OC32CCCCC2)C(=O)C2CCCCC12 |
| InChI | InChI=1S/C48H48N2O6S2/c51-41-27-11-3-4-12-28(27)42(52)39(41)49-37-23-33-45(57-37)31-19-26-22-36-32(20-25(26)21-35(31)55-47(33)15-7-1-8-16-47)46-34(48(56-36)17-9-2-10-18-48)24-38(58-46)50-40-43(53)29-13-5-6-14-30(29)44(40)54/h19-30H,1-18H2 |
| InChIKey | HHEFHUIHWSAZLD-UHFFFAOYSA-N |
| XLogP | 10.74 |
| TPSA | 111.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 813.05 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 164955048 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 164955048?
The IUPAC name of CID 164955048 (CID 164955048) is not available.
What is the SMILES notation for CID 164955048?
The canonical SMILES for CID 164955048 is O=C1C(=Nc2cc3c(s2)C2=CC4C=C5OC6(CCCCC6)c6cc(N=C7C(=O)C8CCCCC8C7=O)sc6C5=CC4C=C2OC32CCCCC2)C(=O)C2CCCCC12.
What is the InChIKey of CID 164955048?
The InChIKey is HHEFHUIHWSAZLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H48N2O6S2/c51-41-27-11-3-4-12-28(27)42(52)39(41)49-37-23-33-45(57-37)31-19-26-22-36-32(20-25(26)21-35(31)55-47(33)15-7-1-8-16-47)46-34(48(56-36)17-9-2-10-18-48)24-38(58-46)50-40-43(53)29-13-5-6-14-30(29)44(40)54/h19-30H,1-18H2.
What are the key properties of CID 164955048?
CID 164955048 has a molecular weight of 813.05 g/mol, XLogP of 10.74, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 164955048 is sourced from PubChem (CID 164955048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).