C8H9N3O2 — CID 164955084
1,6-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione (PubChem CID 164955084) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 1,6-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1,6-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164955084 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1,6-dimethyl-5H-pyrrolo[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC1=Nc2c(c(=O)[nH]c(=O)n2C)C1 |
| InChI | InChI=1S/C8H9N3O2/c1-4-3-5-6(9-4)11(2)8(13)10-7(5)12/h3H2,1-2H3,(H,10,12,13) |
| InChIKey | XYSZLBLPKWDCKY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |