C25H36ClN3O3 — CID 164955461
(2S)-6-[(5-chloro-2-pyridinyl)methyl-ethylamino]-2-[(2R)-2-(3,4-dimethylphenyl)-2-methoxyethyl]-N-hydroxyhexanamide (PubChem CID 164955461) has the molecular formula C25H36ClN3O3 and a molecular weight of 462.03 g/mol. Its IUPAC name is (2S)-6-[(5-chloro-2-pyridinyl)methyl-ethylamino]-2-[(2R)-2-(3,4-dimethylphenyl)-2-methoxyethyl]-N-hydroxyhexanamide.
| Compound Name | (2S)-6-[(5-chloro-2-pyridinyl)methyl-ethylamino]-2-[(2R)-2-(3,4-dimethylphenyl)-2-methoxyethyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 164955461 |
| Molecular Formula | C25H36ClN3O3 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (2S)-6-[(5-chloro-2-pyridinyl)methyl-ethylamino]-2-[(2R)-2-(3,4-dimethylphenyl)-2-methoxyethyl]-N-hydroxyhexanamide |
| SMILES | CCN(CCCCC(C[C@@H](OC)c1ccc(C)c(C)c1)C(=O)NO)Cc1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H36ClN3O3/c1-5-29(17-23-12-11-22(26)16-27-23)13-7-6-8-21(25(30)28-31)15-24(32-4)20-10-9-18(2)19(3)14-20/h9-12,14,16,21,24,31H,5-8,13,15,17H2,1-4H3,(H,28,30)/t21?,24-/m1/s1 |
| InChIKey | FBKHDOCAGBNMNE-MQNHUJCZSA-N |
| XLogP | 5.24 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|