C41H27N3O-2 — CID 164955925
2-dibenzofuran-1-yl-4-phenanthren-2-yl-6-(4-phenylphenyl)-1,3,5-triazine;hydride (PubChem CID 164955925) has the molecular formula C41H27N3O-2 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-dibenzofuran-1-yl-4-phenanthren-2-yl-6-(4-phenylphenyl)-1,3,5-triazine;hydride.
| Compound Name | 2-dibenzofuran-1-yl-4-phenanthren-2-yl-6-(4-phenylphenyl)-1,3,5-triazine;hydride |
|---|---|
| PubChem CID | 164955925 |
| Molecular Formula | C41H27N3O-2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 2-dibenzofuran-1-yl-4-phenanthren-2-yl-6-(4-phenylphenyl)-1,3,5-triazine;hydride |
| SMILES | [H-].[H-].c1ccc(-c2ccc(-c3nc(-c4ccc5c(ccc6ccccc65)c4)nc(-c4cccc5oc6ccccc6c45)n3)cc2)cc1 |
| InChI | InChI=1S/C41H25N3O.2H/c1-2-9-26(10-3-1)27-17-20-29(21-18-27)39-42-40(31-23-24-33-30(25-31)22-19-28-11-4-5-12-32(28)33)44-41(43-39)35-14-8-16-37-38(35)34-13-6-7-15-36(34)45-37;;/h1-25H;;/q;2*-1 |
| InChIKey | BDYLGGWQCDPIGN-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|