About methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate
methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate (PubChem CID 164956999) has the molecular formula C14H30O6Si
and a molecular weight of 322.47 g/mol. Its IUPAC name is methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate |
| PubChem CID | 164956999 |
| Molecular Formula | C14H30O6Si |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](C)O.COC(=O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H22O3Si.C4H8O3/c1-8(9(11)12-5)13-14(6,7)10(2,3)4;1-3(5)4(6)7-2/h8H,1-7H3;3,5H,1-2H3/t8-;3-/m11/s1 |
| InChIKey | BHRRXBVRVPDQHU-CEXNBQKLSA-N |
| XLogP | 2.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate?
The IUPAC name of methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate (CID 164956999) is methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate.
What is the SMILES notation for methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate?
The canonical SMILES for methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate is COC(=O)[C@@H](C)O.COC(=O)[C@@H](C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate?
The InChIKey is BHRRXBVRVPDQHU-CEXNBQKLSA-N. The full InChI is InChI=1S/C10H22O3Si.C4H8O3/c1-8(9(11)12-5)13-14(6,7)10(2,3)4;1-3(5)4(6)7-2/h8H,1-7H3;3,5H,1-2H3/t8-;3-/m11/s1.
What are the key properties of methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate?
methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate has a molecular weight of 322.47 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoate;methyl (2R)-2-hydroxypropanoate is sourced from PubChem (CID 164956999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).