C29H37F3N6O12S — CID 164958711
7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate;7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate (PubChem CID 164958711) has the molecular formula C29H37F3N6O12S and a molecular weight of 750.71 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate;7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate;7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate |
|---|---|
| PubChem CID | 164958711 |
| Molecular Formula | C29H37F3N6O12S |
| Molecular Weight | 750.71 g/mol |
| Exact Mass | 750.21 |
| IUPAC Name | 7-O-tert-butyl 2-O-methyl 4-oxo-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2,7-dicarboxylate;7-O-tert-butyl 2-O-methyl 4-(trifluoromethylsulfonyloxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-2,7-dicarboxylate |
| SMILES | COC(=O)c1nc2c(c(=O)[nH]1)CCN(C(=O)OC(C)(C)C)C2.COC(=O)c1nc2c(c(OS(=O)(=O)C(F)(F)F)n1)CCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C15H18F3N3O7S.C14H19N3O5/c1-14(2,3)27-13(23)21-6-5-8-9(7-21)19-10(12(22)26-4)20-11(8)28-29(24,25)15(16,17)18;1-14(2,3)22-13(20)17-6-5-8-9(7-17)15-10(12(19)21-4)16-11(8)18/h5-7H2,1-4H3;5-7H2,1-4H3,(H,15,16,18) |
| InChIKey | BNLUEXCTIPKBLK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 226.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|